C24H21N5O — CID 153196687
3-[2-[(4-morpholin-4-ylphenyl)methyl]-7H-pyrrolo[3,2-d]pyrimidin-4-yl]benzonitrile (PubChem CID 153196687) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 3-[2-[(4-morpholin-4-ylphenyl)methyl]-7H-pyrrolo[3,2-d]pyrimidin-4-yl]benzonitrile.
| Compound Name | 3-[2-[(4-morpholin-4-ylphenyl)methyl]-7H-pyrrolo[3,2-d]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 153196687 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[2-[(4-morpholin-4-ylphenyl)methyl]-7H-pyrrolo[3,2-d]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(Cc3ccc(N4CCOCC4)cc3)nc3c2N=CC3)c1 |
| InChI | InChI=1S/C24H21N5O/c25-16-18-2-1-3-19(14-18)23-24-21(8-9-26-24)27-22(28-23)15-17-4-6-20(7-5-17)29-10-12-30-13-11-29/h1-7,9,14H,8,10-13,15H2 |
| InChIKey | WJCOVDOEXYSGKQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|