C16H14N6O — CID 46225308
3-(6-morpholin-4-yl-7H-purin-2-yl)benzonitrile (PubChem CID 46225308) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 3-(6-morpholin-4-yl-7H-purin-2-yl)benzonitrile.
| Compound Name | 3-(6-morpholin-4-yl-7H-purin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 46225308 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-(6-morpholin-4-yl-7H-purin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(N3CCOCC3)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C16H14N6O/c17-9-11-2-1-3-12(8-11)14-20-15-13(18-10-19-15)16(21-14)22-4-6-23-7-5-22/h1-3,8,10H,4-7H2,(H,18,19,20,21) |
| InChIKey | ZQVBDWNBAZLZQL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |