C22H21N7O2 — CID 117080367
4-[6-(4-morpholin-4-ylanilino)-7H-purin-2-yl]benzamide (PubChem CID 117080367) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 4-[6-(4-morpholin-4-ylanilino)-7H-purin-2-yl]benzamide.
| Compound Name | 4-[6-(4-morpholin-4-ylanilino)-7H-purin-2-yl]benzamide |
|---|---|
| PubChem CID | 117080367 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-[6-(4-morpholin-4-ylanilino)-7H-purin-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C22H21N7O2/c23-19(30)14-1-3-15(4-2-14)20-27-21-18(24-13-25-21)22(28-20)26-16-5-7-17(8-6-16)29-9-11-31-12-10-29/h1-8,13H,9-12H2,(H2,23,30)(H2,24,25,26,27,28) |
| InChIKey | YJMMWZGMZDKSDR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|