C23H22N6O3 — CID 118413153
2-methyl-4-[7-(4-morpholin-4-ylanilino)-1H-pyrazolo[4,5-d]pyrimidin-5-yl]benzoic acid (PubChem CID 118413153) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-methyl-4-[7-(4-morpholin-4-ylanilino)-1H-pyrazolo[4,5-d]pyrimidin-5-yl]benzoic acid.
| Compound Name | 2-methyl-4-[7-(4-morpholin-4-ylanilino)-1H-pyrazolo[4,5-d]pyrimidin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 118413153 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-methyl-4-[7-(4-morpholin-4-ylanilino)-1H-pyrazolo[4,5-d]pyrimidin-5-yl]benzoic acid |
| SMILES | Cc1cc(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3[nH]ncc3n2)ccc1C(=O)O |
| InChI | InChI=1S/C23H22N6O3/c1-14-12-15(2-7-18(14)23(30)31)21-26-19-13-24-28-20(19)22(27-21)25-16-3-5-17(6-4-16)29-8-10-32-11-9-29/h2-7,12-13H,8-11H2,1H3,(H,24,28)(H,30,31)(H,25,26,27) |
| InChIKey | RPYCBIUXKDDVLK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|