C21H19FN6O — CID 71138155
5-(2-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 71138155) has the molecular formula C21H19FN6O and a molecular weight of 390.42 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-(2-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71138155 |
| Molecular Formula | C21H19FN6O |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 5-(2-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Fc1ccccc1-c1nc(Nc2ccc(N3CCOCC3)cc2)c2[nH]ncc2n1 |
| InChI | InChI=1S/C21H19FN6O/c22-17-4-2-1-3-16(17)20-25-18-13-23-27-19(18)21(26-20)24-14-5-7-15(8-6-14)28-9-11-29-12-10-28/h1-8,13H,9-12H2,(H,23,27)(H,24,25,26) |
| InChIKey | XRTNAYPBYKOCDV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|