C19H18N6O — CID 71139410
N-(4-morpholin-4-ylphenyl)-7H-pyrazolo[5,4-c][1,5]naphthyridin-6-amine (PubChem CID 71139410) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-7H-pyrazolo[5,4-c][1,5]naphthyridin-6-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-7H-pyrazolo[5,4-c][1,5]naphthyridin-6-amine |
|---|---|
| PubChem CID | 71139410 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-7H-pyrazolo[5,4-c][1,5]naphthyridin-6-amine |
| SMILES | c1cnc2c(c1)nc(Nc1ccc(N3CCOCC3)cc1)c1[nH]ncc12 |
| InChI | InChI=1S/C19H18N6O/c1-2-16-17(20-7-1)15-12-21-24-18(15)19(23-16)22-13-3-5-14(6-4-13)25-8-10-26-11-9-25/h1-7,12H,8-11H2,(H,21,24)(H,22,23) |
| InChIKey | WEHXMNDIPQHTMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|