C25H28N6O — CID 71139473
N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine (PubChem CID 71139473) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine.
| Compound Name | N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 71139473 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine |
| SMILES | COc1ccc2nc(Nc3ccc(N4CCN(CC5CC5)CC4)cc3)c3[nH]ncc3c2c1 |
| InChI | InChI=1S/C25H28N6O/c1-32-20-8-9-23-21(14-20)22-15-26-29-24(22)25(28-23)27-18-4-6-19(7-5-18)31-12-10-30(11-13-31)16-17-2-3-17/h4-9,14-15,17H,2-3,10-13,16H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | ZYHANWAQDSCDKE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|