C22H23N5O3 — CID 70977016
7,8-dimethoxy-N-(4-morpholin-4-ylphenyl)-3H-pyrazolo[5,4-c]quinolin-4-amine (PubChem CID 70977016) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 7,8-dimethoxy-N-(4-morpholin-4-ylphenyl)-3H-pyrazolo[5,4-c]quinolin-4-amine.
| Compound Name | 7,8-dimethoxy-N-(4-morpholin-4-ylphenyl)-3H-pyrazolo[5,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 70977016 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 7,8-dimethoxy-N-(4-morpholin-4-ylphenyl)-3H-pyrazolo[5,4-c]quinolin-4-amine |
| SMILES | COc1cc2nc(Nc3ccc(N4CCOCC4)cc3)c3[nH]ncc3c2cc1OC |
| InChI | InChI=1S/C22H23N5O3/c1-28-19-11-16-17-13-23-26-21(17)22(25-18(16)12-20(19)29-2)24-14-3-5-15(6-4-14)27-7-9-30-10-8-27/h3-6,11-13H,7-10H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | AACPZIRSUYSTED-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|