C29H33N7O3 — CID 117084289
6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 117084289) has the molecular formula C29H33N7O3 and a molecular weight of 527.63 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 117084289 |
| Molecular Formula | C29H33N7O3 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCN(c4ccccn4)CC3)nc(Nc3ccc(N4CCOCC4)cc3)c2cc1OC |
| InChI | InChI=1S/C29H33N7O3/c1-37-25-19-23-24(20-26(25)38-2)32-29(36-13-11-35(12-14-36)27-5-3-4-10-30-27)33-28(23)31-21-6-8-22(9-7-21)34-15-17-39-18-16-34/h3-10,19-20H,11-18H2,1-2H3,(H,31,32,33) |
| InChIKey | PUGJDZUWMDZYML-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|