C26H34N6O4 — CID 117090622
6,7-dimethoxy-4-N-(2-morpholin-4-ylethyl)-2-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine (PubChem CID 117090622) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is 6,7-dimethoxy-4-N-(2-morpholin-4-ylethyl)-2-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-4-N-(2-morpholin-4-ylethyl)-2-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 117090622 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 6,7-dimethoxy-4-N-(2-morpholin-4-ylethyl)-2-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3ccc(N4CCOCC4)cc3)nc(NCCN3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C26H34N6O4/c1-33-23-17-21-22(18-24(23)34-2)29-26(30-25(21)27-7-8-31-9-13-35-14-10-31)28-19-3-5-20(6-4-19)32-11-15-36-16-12-32/h3-6,17-18H,7-16H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | UJIZYKVVOAZXNA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|