C29H38N4O3 — CID 163559169
6,7-dimethoxy-4-N-[(4-methylcyclohexyl)methyl]-2-N-(4-morpholin-4-ylphenyl)quinoline-2,4-diamine (PubChem CID 163559169) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 6,7-dimethoxy-4-N-[(4-methylcyclohexyl)methyl]-2-N-(4-morpholin-4-ylphenyl)quinoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-4-N-[(4-methylcyclohexyl)methyl]-2-N-(4-morpholin-4-ylphenyl)quinoline-2,4-diamine |
|---|---|
| PubChem CID | 163559169 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 6,7-dimethoxy-4-N-[(4-methylcyclohexyl)methyl]-2-N-(4-morpholin-4-ylphenyl)quinoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3ccc(N4CCOCC4)cc3)cc(NCC3CCC(C)CC3)c2cc1OC |
| InChI | InChI=1S/C29H38N4O3/c1-20-4-6-21(7-5-20)19-30-25-18-29(32-26-17-28(35-3)27(34-2)16-24(25)26)31-22-8-10-23(11-9-22)33-12-14-36-15-13-33/h8-11,16-18,20-21H,4-7,12-15,19H2,1-3H3,(H2,30,31,32) |
| InChIKey | FPSFRDJMRZPVIV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 67.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|