C24H25F2N5O3 — CID 67423490
4-[(3,5-difluorophenyl)methylamino]-2-methoxy-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide (PubChem CID 67423490) has the molecular formula C24H25F2N5O3 and a molecular weight of 469.49 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methylamino]-2-methoxy-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide.
| Compound Name | 4-[(3,5-difluorophenyl)methylamino]-2-methoxy-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67423490 |
| Molecular Formula | C24H25F2N5O3 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methylamino]-2-methoxy-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
| SMILES | COc1nc(Nc2ccc(N3CCOCC3)cc2)cc(NCc2cc(F)cc(F)c2)c1C(N)=O |
| InChI | InChI=1S/C24H25F2N5O3/c1-33-24-22(23(27)32)20(28-14-15-10-16(25)12-17(26)11-15)13-21(30-24)29-18-2-4-19(5-3-18)31-6-8-34-9-7-31/h2-5,10-13H,6-9,14H2,1H3,(H2,27,32)(H2,28,29,30) |
| InChIKey | UPSGCRACDZGXIE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|