C26H29ClF2N6O — CID 131730971
2-[6-[4-[4-(2-chloroethyl)piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]-3-pyridinyl]acetamide (PubChem CID 131730971) has the molecular formula C26H29ClF2N6O and a molecular weight of 515.01 g/mol. Its IUPAC name is 2-[6-[4-[4-(2-chloroethyl)piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]-3-pyridinyl]acetamide.
| Compound Name | 2-[6-[4-[4-(2-chloroethyl)piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 131730971 |
| Molecular Formula | C26H29ClF2N6O |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-[6-[4-[4-(2-chloroethyl)piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]-3-pyridinyl]acetamide |
| SMILES | NC(=O)Cc1cnc(Nc2ccc(N3CCN(CCCl)CC3)cc2)cc1NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C26H29ClF2N6O/c27-5-6-34-7-9-35(10-8-34)23-3-1-22(2-4-23)33-26-15-24(19(17-32-26)13-25(30)36)31-16-18-11-20(28)14-21(29)12-18/h1-4,11-12,14-15,17H,5-10,13,16H2,(H2,30,36)(H2,31,32,33) |
| InChIKey | AALLDEYDXQOOTL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|