C24H25F2N5O3 — CID 67423489
4-[[(3,5-difluorophenyl)methylamino]methoxy]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide (PubChem CID 67423489) has the molecular formula C24H25F2N5O3 and a molecular weight of 469.49 g/mol. Its IUPAC name is 4-[[(3,5-difluorophenyl)methylamino]methoxy]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide.
| Compound Name | 4-[[(3,5-difluorophenyl)methylamino]methoxy]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67423489 |
| Molecular Formula | C24H25F2N5O3 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-[[(3,5-difluorophenyl)methylamino]methoxy]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCOCC3)cc2)cc1OCNCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H25F2N5O3/c25-17-9-16(10-18(26)11-17)13-28-15-34-22-12-23(29-14-21(22)24(27)32)30-19-1-3-20(4-2-19)31-5-7-33-8-6-31/h1-4,9-12,14,28H,5-8,13,15H2,(H2,27,32)(H,29,30) |
| InChIKey | OVISORDGSLBWHG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|