C26H30F2N6O — CID 58450483
4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propylpiperazin-1-yl)anilino]pyridine-3-carboxamide (PubChem CID 58450483) has the molecular formula C26H30F2N6O and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propylpiperazin-1-yl)anilino]pyridine-3-carboxamide.
| Compound Name | 4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propylpiperazin-1-yl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58450483 |
| Molecular Formula | C26H30F2N6O |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propylpiperazin-1-yl)anilino]pyridine-3-carboxamide |
| SMILES | CCCN1CCN(c2ccc(Nc3cc(NCc4cc(F)cc(F)c4)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C26H30F2N6O/c1-2-7-33-8-10-34(11-9-33)22-5-3-21(4-6-22)32-25-15-24(23(17-31-25)26(29)35)30-16-18-12-19(27)14-20(28)13-18/h3-6,12-15,17H,2,7-11,16H2,1H3,(H2,29,35)(H2,30,31,32) |
| InChIKey | HXZUCEHRVUCKES-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|