C29H38N8O3 — CID 46219969
6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide (PubChem CID 46219969) has the molecular formula C29H38N8O3 and a molecular weight of 546.68 g/mol. Its IUPAC name is 6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46219969 |
| Molecular Formula | C29H38N8O3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide |
| SMILES | CCN(CC)CCN1CCN(c2ccc(Nc3cc(NCc4cccc([N+](=O)[O-])c4)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C29H38N8O3/c1-3-34(4-2)12-13-35-14-16-36(17-15-35)24-10-8-23(9-11-24)33-28-19-27(26(21-32-28)29(30)38)31-20-22-6-5-7-25(18-22)37(39)40/h5-11,18-19,21H,3-4,12-17,20H2,1-2H3,(H2,30,38)(H2,31,32,33) |
| InChIKey | WFUMCZQNMDAIKK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|