C25H24F3N7O4 — CID 58450669
4-[(3-nitrophenyl)methylamino]-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyridine-3-carboxamide (PubChem CID 58450669) has the molecular formula C25H24F3N7O4 and a molecular weight of 543.51 g/mol. Its IUPAC name is 4-[(3-nitrophenyl)methylamino]-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyridine-3-carboxamide.
| Compound Name | 4-[(3-nitrophenyl)methylamino]-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58450669 |
| Molecular Formula | C25H24F3N7O4 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 4-[(3-nitrophenyl)methylamino]-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCN(C(=O)C(F)(F)F)CC3)cc2)cc1NCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H24F3N7O4/c26-25(27,28)24(37)34-10-8-33(9-11-34)18-6-4-17(5-7-18)32-22-13-21(20(15-31-22)23(29)36)30-14-16-2-1-3-19(12-16)35(38)39/h1-7,12-13,15H,8-11,14H2,(H2,29,36)(H2,30,31,32) |
| InChIKey | AMTGGXMEHZTDFE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|