C23H25N5O2 — CID 46218740
4-(benzylamino)-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide (PubChem CID 46218740) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-(benzylamino)-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide.
| Compound Name | 4-(benzylamino)-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46218740 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-(benzylamino)-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCOCC3)cc2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C23H25N5O2/c24-23(29)20-16-26-22(14-21(20)25-15-17-4-2-1-3-5-17)27-18-6-8-19(9-7-18)28-10-12-30-13-11-28/h1-9,14,16H,10-13,15H2,(H2,24,29)(H2,25,26,27) |
| InChIKey | UKIMCASXXKWCPW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|