C25H29N5O4S — CID 58450705
4-[[3-(methylsulfonylmethyl)phenyl]methylamino]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide (PubChem CID 58450705) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 4-[[3-(methylsulfonylmethyl)phenyl]methylamino]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide.
| Compound Name | 4-[[3-(methylsulfonylmethyl)phenyl]methylamino]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58450705 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[[3-(methylsulfonylmethyl)phenyl]methylamino]-6-(4-morpholin-4-ylanilino)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)Cc1cccc(CNc2cc(Nc3ccc(N4CCOCC4)cc3)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C25H29N5O4S/c1-35(32,33)17-19-4-2-3-18(13-19)15-27-23-14-24(28-16-22(23)25(26)31)29-20-5-7-21(8-6-20)30-9-11-34-12-10-30/h2-8,13-14,16H,9-12,15,17H2,1H3,(H2,26,31)(H2,27,28,29) |
| InChIKey | IMICJURIZKFYSN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|