C26H27F3N6O2 — CID 87394872
4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]pyridine-3-carboxamide (PubChem CID 87394872) has the molecular formula C26H27F3N6O2 and a molecular weight of 512.54 g/mol. Its IUPAC name is 4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]pyridine-3-carboxamide.
| Compound Name | 4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87394872 |
| Molecular Formula | C26H27F3N6O2 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCCN(C(=O)C(F)(F)F)CC3)cc2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C26H27F3N6O2/c27-26(28,29)25(37)35-12-4-11-34(13-14-35)20-9-7-19(8-10-20)33-23-15-22(21(17-32-23)24(30)36)31-16-18-5-2-1-3-6-18/h1-3,5-10,15,17H,4,11-14,16H2,(H2,30,36)(H2,31,32,33) |
| InChIKey | CTJOQBBAAARAPQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|