C27H29F3N6O2 — CID 131730954
2-[4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]-3-pyridinyl]acetamide (PubChem CID 131730954) has the molecular formula C27H29F3N6O2 and a molecular weight of 526.56 g/mol. Its IUPAC name is 2-[4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]-3-pyridinyl]acetamide.
| Compound Name | 2-[4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 131730954 |
| Molecular Formula | C27H29F3N6O2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 2-[4-(benzylamino)-6-[4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]anilino]-3-pyridinyl]acetamide |
| SMILES | NC(=O)Cc1cnc(Nc2ccc(N3CCCN(C(=O)C(F)(F)F)CC3)cc2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C27H29F3N6O2/c28-27(29,30)26(38)36-12-4-11-35(13-14-36)22-9-7-21(8-10-22)34-25-16-23(20(18-33-25)15-24(31)37)32-17-19-5-2-1-3-6-19/h1-3,5-10,16,18H,4,11-15,17H2,(H2,31,37)(H2,32,33,34) |
| InChIKey | VSTYJUUKLPKNBX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|