C29H36N8O4 — CID 46220395
6-[4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide (PubChem CID 46220395) has the molecular formula C29H36N8O4 and a molecular weight of 560.66 g/mol. Its IUPAC name is 6-[4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-[4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46220395 |
| Molecular Formula | C29H36N8O4 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 6-[4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]anilino]-4-[(3-nitrophenyl)methylamino]pyridine-3-carboxamide |
| SMILES | CCN(CC)CC(=O)N1CCN(c2ccc(Nc3cc(NCc4cccc([N+](=O)[O-])c4)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C29H36N8O4/c1-3-34(4-2)20-28(38)36-14-12-35(13-15-36)23-10-8-22(9-11-23)33-27-17-26(25(19-32-27)29(30)39)31-18-21-6-5-7-24(16-21)37(40)41/h5-11,16-17,19H,3-4,12-15,18,20H2,1-2H3,(H2,30,39)(H2,31,32,33) |
| InChIKey | SURZTTAFPBOVKN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 149.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|