C29H37F2N7O — CID 67422918
6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]pyridine-3-carboxamide (PubChem CID 67422918) has the molecular formula C29H37F2N7O and a molecular weight of 537.66 g/mol. Its IUPAC name is 6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67422918 |
| Molecular Formula | C29H37F2N7O |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 6-[4-[4-[2-(diethylamino)ethyl]piperazin-1-yl]anilino]-4-[(3,5-difluorophenyl)methylamino]pyridine-3-carboxamide |
| SMILES | CCN(CC)CCN1CCN(c2ccc(Nc3cc(NCc4cc(F)cc(F)c4)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C29H37F2N7O/c1-3-36(4-2)9-10-37-11-13-38(14-12-37)25-7-5-24(6-8-25)35-28-18-27(26(20-34-28)29(32)39)33-19-21-15-22(30)17-23(31)16-21/h5-8,15-18,20H,3-4,9-14,19H2,1-2H3,(H2,32,39)(H2,33,34,35) |
| InChIKey | KYIVUCWKPYTTET-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|