C27H33F2N6OS+ — CID 163860939
4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propan-2-ylsulfanyl-1,4-diazepan-4-ium-1-yl)anilino]pyridine-3-carboxamide (PubChem CID 163860939) has the molecular formula C27H33F2N6OS+ and a molecular weight of 527.67 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propan-2-ylsulfanyl-1,4-diazepan-4-ium-1-yl)anilino]pyridine-3-carboxamide.
| Compound Name | 4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propan-2-ylsulfanyl-1,4-diazepan-4-ium-1-yl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163860939 |
| Molecular Formula | C27H33F2N6OS+ |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methylamino]-6-[4-(4-propan-2-ylsulfanyl-1,4-diazepan-4-ium-1-yl)anilino]pyridine-3-carboxamide |
| SMILES | CC(C)S[NH+]1CCCN(c2ccc(Nc3cc(NCc4cc(F)cc(F)c4)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H32F2N6OS/c1-18(2)37-35-9-3-8-34(10-11-35)23-6-4-22(5-7-23)33-26-15-25(24(17-32-26)27(30)36)31-16-19-12-20(28)14-21(29)13-19/h4-7,12-15,17-18H,3,8-11,16H2,1-2H3,(H2,30,36)(H2,31,32,33)/p+1 |
| InChIKey | PCLLPWIXFIRLSD-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|