C28H32N6O3 — CID 117079834
2-N-[3-(dimethylamino)phenyl]-6,7-dimethoxy-4-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine (PubChem CID 117079834) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)phenyl]-6,7-dimethoxy-4-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)phenyl]-6,7-dimethoxy-4-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 117079834 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-N-[3-(dimethylamino)phenyl]-6,7-dimethoxy-4-N-(4-morpholin-4-ylphenyl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3cccc(N(C)C)c3)nc(Nc3ccc(N4CCOCC4)cc3)c2cc1OC |
| InChI | InChI=1S/C28H32N6O3/c1-33(2)22-7-5-6-20(16-22)30-28-31-24-18-26(36-4)25(35-3)17-23(24)27(32-28)29-19-8-10-21(11-9-19)34-12-14-37-15-13-34/h5-11,16-18H,12-15H2,1-4H3,(H2,29,30,31,32) |
| InChIKey | XDIZZQBJTNMOTE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|