C20H21ClN4O3 — CID 22693013
2-chloro-6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine (PubChem CID 22693013) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 2-chloro-6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine.
| Compound Name | 2-chloro-6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 22693013 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-chloro-6,7-dimethoxy-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(Cl)nc(Nc3ccc(N4CCOCC4)cc3)c2cc1OC |
| InChI | InChI=1S/C20H21ClN4O3/c1-26-17-11-15-16(12-18(17)27-2)23-20(21)24-19(15)22-13-3-5-14(6-4-13)25-7-9-28-10-8-25/h3-6,11-12H,7-10H2,1-2H3,(H,22,23,24) |
| InChIKey | IWFNXXZAJSQBOK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|