C20H22N4O3 — CID 71738609
6,7-dimethoxy-2-morpholin-4-yl-N-phenylquinazolin-4-amine (PubChem CID 71738609) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 6,7-dimethoxy-2-morpholin-4-yl-N-phenylquinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-2-morpholin-4-yl-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 71738609 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 6,7-dimethoxy-2-morpholin-4-yl-N-phenylquinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCOCC3)nc(Nc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C20H22N4O3/c1-25-17-12-15-16(13-18(17)26-2)22-20(24-8-10-27-11-9-24)23-19(15)21-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H,21,22,23) |
| InChIKey | HKXUNUNPALUAPG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |