C15H19N3O4 — CID 22082862
4-(4,6,7-trimethoxyquinazolin-2-yl)morpholine (PubChem CID 22082862) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-(4,6,7-trimethoxyquinazolin-2-yl)morpholine.
| Compound Name | 4-(4,6,7-trimethoxyquinazolin-2-yl)morpholine |
|---|---|
| PubChem CID | 22082862 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-(4,6,7-trimethoxyquinazolin-2-yl)morpholine |
| SMILES | COc1cc2nc(N3CCOCC3)nc(OC)c2cc1OC |
| InChI | InChI=1S/C15H19N3O4/c1-19-12-8-10-11(9-13(12)20-2)16-15(17-14(10)21-3)18-4-6-22-7-5-18/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZPPGIAJHTBCXOF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |