C14H17N3O3 — CID 58674716
4-(6,7-dimethoxycinnolin-4-yl)morpholine (PubChem CID 58674716) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-(6,7-dimethoxycinnolin-4-yl)morpholine.
| Compound Name | 4-(6,7-dimethoxycinnolin-4-yl)morpholine |
|---|---|
| PubChem CID | 58674716 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(6,7-dimethoxycinnolin-4-yl)morpholine |
| SMILES | COc1cc2nncc(N3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C14H17N3O3/c1-18-13-7-10-11(8-14(13)19-2)16-15-9-12(10)17-3-5-20-6-4-17/h7-9H,3-6H2,1-2H3 |
| InChIKey | PFPLJYUNHMUIBK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |