C17H25N5O2 — CID 3031652
2-[4-(dimethylamino)piperidin-1-yl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 3031652) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[4-(dimethylamino)piperidin-1-yl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 2-[4-(dimethylamino)piperidin-1-yl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 3031652 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2-[4-(dimethylamino)piperidin-1-yl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCC(N(C)C)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C17H25N5O2/c1-21(2)11-5-7-22(8-6-11)17-19-13-10-15(24-4)14(23-3)9-12(13)16(18)20-17/h9-11H,5-8H2,1-4H3,(H2,18,19,20) |
| InChIKey | ZKOFLFLVWMUYDN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |