C14H18AlN5O4S — CID 163462957
CID 163462957 (PubChem CID 163462957) has the molecular formula C14H18AlN5O4S and a molecular weight of 379.38 g/mol.
| Compound Name | CID 163462957 |
|---|---|
| PubChem CID | 163462957 |
| Molecular Formula | C14H18AlN5O4S |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | — |
| SMILES | COc1cc2nc(N3CCN([S-](=O)=O)CC3)nc(N)c2cc1OC.[Al+] |
| InChI | InChI=1S/C14H18N5O4S.Al/c1-22-11-7-9-10(8-12(11)23-2)16-14(17-13(9)15)18-3-5-19(6-4-18)24(20)21;/h7-8H,3-6H2,1-2H3,(H2,15,16,17);/q-1;+1 |
| InChIKey | ZNXWPBCQWXYAID-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|