C39H54N10O6 — CID 137398803
1,7-bis[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3,5,5-tetramethylheptane-1,7-dione (PubChem CID 137398803) has the molecular formula C39H54N10O6 and a molecular weight of 758.93 g/mol. Its IUPAC name is 1,7-bis[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3,5,5-tetramethylheptane-1,7-dione.
| Compound Name | 1,7-bis[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3,5,5-tetramethylheptane-1,7-dione |
|---|---|
| PubChem CID | 137398803 |
| Molecular Formula | C39H54N10O6 |
| Molecular Weight | 758.93 g/mol |
| Exact Mass | 758.42 |
| IUPAC Name | 1,7-bis[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3,5,5-tetramethylheptane-1,7-dione |
| SMILES | COc1cc2nc(N3CCN(C(=O)CC(C)(C)CC(C)(C)CC(=O)N4CCN(c5nc(N)c6cc(OC)c(OC)cc6n5)CC4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C39H54N10O6/c1-38(2,21-32(50)46-9-13-48(14-10-46)36-42-26-19-30(54-7)28(52-5)17-24(26)34(40)44-36)23-39(3,4)22-33(51)47-11-15-49(16-12-47)37-43-27-20-31(55-8)29(53-6)18-25(27)35(41)45-37/h17-20H,9-16,21-23H2,1-8H3,(H2,40,42,44)(H2,41,43,45) |
| InChIKey | XNXSDNGMYOUTIF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |