C24H27N5O3 — CID 54438711
1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one (PubChem CID 54438711) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54438711 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc2nc(N3CCN(C(=O)C=Cc4cccc(C)c4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C24H27N5O3/c1-16-5-4-6-17(13-16)7-8-22(30)28-9-11-29(12-10-28)24-26-19-15-21(32-3)20(31-2)14-18(19)23(25)27-24/h4-8,13-15H,9-12H2,1-3H3,(H2,25,26,27) |
| InChIKey | WMOHNUNXXAXDGG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|