C22H26ClN5O4 — CID 13100447
(E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one;hydrochloride (PubChem CID 13100447) has the molecular formula C22H26ClN5O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 13100447 |
| Molecular Formula | C22H26ClN5O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one;hydrochloride |
| SMILES | COc1cc2nc(N3CCN(C(=O)/C=C/c4ccc(C)o4)CC3)nc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C22H25N5O4.ClH/c1-14-4-5-15(31-14)6-7-20(28)26-8-10-27(11-9-26)22-24-17-13-19(30-3)18(29-2)12-16(17)21(23)25-22;/h4-7,12-13H,8-11H2,1-3H3,(H2,23,24,25);1H/b7-6+; |
| InChIKey | NMQADYQMIIDANJ-UHDJGPCESA-N |
| XLogP | 2.91 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|