C21H24ClN5O4 — CID 13100443
(E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one;hydrochloride (PubChem CID 13100443) has the molecular formula C21H24ClN5O4 and a molecular weight of 445.91 g/mol. Its IUPAC name is (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 13100443 |
| Molecular Formula | C21H24ClN5O4 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one;hydrochloride |
| SMILES | COc1cc2nc(N3CCN(C(=O)/C=C/c4ccco4)CC3)nc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C21H23N5O4.ClH/c1-28-17-12-15-16(13-18(17)29-2)23-21(24-20(15)22)26-9-7-25(8-10-26)19(27)6-5-14-4-3-11-30-14;/h3-6,11-13H,7-10H2,1-2H3,(H2,22,23,24);1H/b6-5+; |
| InChIKey | HJLCDHHCMDDUPE-IPZCTEOASA-N |
| XLogP | 2.61 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|