C14H18N5O4S- — CID 163462958
4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-sulfinate (PubChem CID 163462958) has the molecular formula C14H18N5O4S- and a molecular weight of 352.40 g/mol. Its IUPAC name is 4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-sulfinate.
| Compound Name | 4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-sulfinate |
|---|---|
| PubChem CID | 163462958 |
| Molecular Formula | C14H18N5O4S- |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-sulfinate |
| SMILES | COc1cc2nc(N3CCN(S(=O)[O-])CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C14H19N5O4S/c1-22-11-7-9-10(8-12(11)23-2)16-14(17-13(9)15)18-3-5-19(6-4-18)24(20)21/h7-8H,3-6H2,1-2H3,(H,20,21)(H2,15,16,17)/p-1 |
| InChIKey | CGUHYMGTLOHDEN-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|