C18H23N5O2 — CID 133453712
2-(4-but-3-ynylpiperazin-1-yl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 133453712) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-(4-but-3-ynylpiperazin-1-yl)-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 2-(4-but-3-ynylpiperazin-1-yl)-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 133453712 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-(4-but-3-ynylpiperazin-1-yl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | C#CCCN1CCN(c2nc(N)c3cc(OC)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C18H23N5O2/c1-4-5-6-22-7-9-23(10-8-22)18-20-14-12-16(25-3)15(24-2)11-13(14)17(19)21-18/h1,11-12H,5-10H2,2-3H3,(H2,19,20,21) |
| InChIKey | DMKBVYQHXRBSFU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|