C17H24N4O2 — CID 166201599
2-(4-ethylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 166201599) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-(4-ethylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 2-(4-ethylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 166201599 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-(4-ethylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | CCC1CCN(c2nc(N)c3cc(OC)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C17H24N4O2/c1-4-11-5-7-21(8-6-11)17-19-13-10-15(23-3)14(22-2)9-12(13)16(18)20-17/h9-11H,4-8H2,1-3H3,(H2,18,19,20) |
| InChIKey | HVUZVRRUSFJZCC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |