C19H23N5O4 — CID 54550308
1-[1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidin-4-yl]pyrrole-2,5-diol (PubChem CID 54550308) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-[1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidin-4-yl]pyrrole-2,5-diol.
| Compound Name | 1-[1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidin-4-yl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54550308 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidin-4-yl]pyrrole-2,5-diol |
| SMILES | COc1cc2nc(N3CCC(n4c(O)ccc4O)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C19H23N5O4/c1-27-14-9-12-13(10-15(14)28-2)21-19(22-18(12)20)23-7-5-11(6-8-23)24-16(25)3-4-17(24)26/h3-4,9-11,25-26H,5-8H2,1-2H3,(H2,20,21,22) |
| InChIKey | ZJKPZZMOXRGFAF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |