C20H22N4O2 — CID 133299996
6,7-dimethoxy-2-(3-phenylpyrrolidin-1-yl)quinazolin-4-amine (PubChem CID 133299996) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(3-phenylpyrrolidin-1-yl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-2-(3-phenylpyrrolidin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 133299996 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 6,7-dimethoxy-2-(3-phenylpyrrolidin-1-yl)quinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCC(c4ccccc4)C3)nc(N)c2cc1OC |
| InChI | InChI=1S/C20H22N4O2/c1-25-17-10-15-16(11-18(17)26-2)22-20(23-19(15)21)24-9-8-14(12-24)13-6-4-3-5-7-13/h3-7,10-11,14H,8-9,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | NHBMHRLXZBUFDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |