C22H26N4O3 — CID 166190492
2-[4-(2,4,6-trimethoxyphenyl)piperidin-1-yl]quinazolin-4-amine (PubChem CID 166190492) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[4-(2,4,6-trimethoxyphenyl)piperidin-1-yl]quinazolin-4-amine.
| Compound Name | 2-[4-(2,4,6-trimethoxyphenyl)piperidin-1-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 166190492 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[4-(2,4,6-trimethoxyphenyl)piperidin-1-yl]quinazolin-4-amine |
| SMILES | COc1cc(OC)c(C2CCN(c3nc(N)c4ccccc4n3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H26N4O3/c1-27-15-12-18(28-2)20(19(13-15)29-3)14-8-10-26(11-9-14)22-24-17-7-5-4-6-16(17)21(23)25-22/h4-7,12-14H,8-11H2,1-3H3,(H2,23,24,25) |
| InChIKey | MDCMMTLAAPMBQM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |