C21H30N6O4 — CID 19063102
3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-N-butyl-3-oxopropanamide (PubChem CID 19063102) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-N-butyl-3-oxopropanamide.
| Compound Name | 3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-N-butyl-3-oxopropanamide |
|---|---|
| PubChem CID | 19063102 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-N-butyl-3-oxopropanamide |
| SMILES | CCCCNC(=O)CC(=O)N1CCN(c2nc(N)c3cc(OC)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C21H30N6O4/c1-4-5-6-23-18(28)13-19(29)26-7-9-27(10-8-26)21-24-15-12-17(31-3)16(30-2)11-14(15)20(22)25-21/h11-12H,4-10,13H2,1-3H3,(H,23,28)(H2,22,24,25) |
| InChIKey | ZETURXVTPJOGMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|