C18H25N5O2 — CID 137380754
6,7-dimethoxy-2-piperazin-1-yl-4-pyrrolidin-1-ylquinazoline (PubChem CID 137380754) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6,7-dimethoxy-2-piperazin-1-yl-4-pyrrolidin-1-ylquinazoline.
| Compound Name | 6,7-dimethoxy-2-piperazin-1-yl-4-pyrrolidin-1-ylquinazoline |
|---|---|
| PubChem CID | 137380754 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 6,7-dimethoxy-2-piperazin-1-yl-4-pyrrolidin-1-ylquinazoline |
| SMILES | COc1cc2nc(N3CCNCC3)nc(N3CCCC3)c2cc1OC |
| InChI | InChI=1S/C18H25N5O2/c1-24-15-11-13-14(12-16(15)25-2)20-18(23-9-5-19-6-10-23)21-17(13)22-7-3-4-8-22/h11-12,19H,3-10H2,1-2H3 |
| InChIKey | OVWCDTNEJISBNH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |