C16H21N5O3 — CID 616327
N-(6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-yl)acetamide (PubChem CID 616327) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-yl)acetamide.
| Compound Name | N-(6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-yl)acetamide |
|---|---|
| PubChem CID | 616327 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-yl)acetamide |
| SMILES | COc1cc2nc(N3CCNCC3)nc(NC(C)=O)c2cc1OC |
| InChI | InChI=1S/C16H21N5O3/c1-10(22)18-15-11-8-13(23-2)14(24-3)9-12(11)19-16(20-15)21-6-4-17-5-7-21/h8-9,17H,4-7H2,1-3H3,(H,18,19,20,22) |
| InChIKey | SAMAEKWIEGUVDP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |