C27H43N7O4 — CID 145433704
N-hydroxy-7-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-4-(piperidin-4-ylamino)quinazolin-7-yl]oxyheptanamide (PubChem CID 145433704) has the molecular formula C27H43N7O4 and a molecular weight of 529.69 g/mol. Its IUPAC name is N-hydroxy-7-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-4-(piperidin-4-ylamino)quinazolin-7-yl]oxyheptanamide.
| Compound Name | N-hydroxy-7-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-4-(piperidin-4-ylamino)quinazolin-7-yl]oxyheptanamide |
|---|---|
| PubChem CID | 145433704 |
| Molecular Formula | C27H43N7O4 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | N-hydroxy-7-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-4-(piperidin-4-ylamino)quinazolin-7-yl]oxyheptanamide |
| SMILES | COc1cc2c(NC3CCNCC3)nc(N3CCCN(C)CC3)nc2cc1OCCCCCCC(=O)NO |
| InChI | InChI=1S/C27H43N7O4/c1-33-13-7-14-34(16-15-33)27-30-22-19-24(38-17-6-4-3-5-8-25(35)32-36)23(37-2)18-21(22)26(31-27)29-20-9-11-28-12-10-20/h18-20,28,36H,3-17H2,1-2H3,(H,32,35)(H,29,30,31) |
| InChIKey | AUQVXPXCLGMRAQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|