C34H47N7O5 — CID 155564436
8-[4-[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide (PubChem CID 155564436) has the molecular formula C34H47N7O5 and a molecular weight of 633.79 g/mol. Its IUPAC name is 8-[4-[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide.
| Compound Name | 8-[4-[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide |
|---|---|
| PubChem CID | 155564436 |
| Molecular Formula | C34H47N7O5 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.36 |
| IUPAC Name | 8-[4-[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide |
| SMILES | COc1cc2nc(N3CCN(C(=O)CCCCCCC(=O)NO)CC3)nc(NC3CCN(Cc4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C34H47N7O5/c1-45-29-22-27-28(23-30(29)46-2)36-34(37-33(27)35-26-14-16-39(17-15-26)24-25-10-6-5-7-11-25)41-20-18-40(19-21-41)32(43)13-9-4-3-8-12-31(42)38-44/h5-7,10-11,22-23,26,44H,3-4,8-9,12-21,24H2,1-2H3,(H,38,42)(H,35,36,37) |
| InChIKey | XASNFRYFNJAIQT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|