C26H34N6O — CID 145433688
4-[(1-benzylpiperidin-4-yl)amino]-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-7-ol (PubChem CID 145433688) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 4-[(1-benzylpiperidin-4-yl)amino]-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-7-ol.
| Compound Name | 4-[(1-benzylpiperidin-4-yl)amino]-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-7-ol |
|---|---|
| PubChem CID | 145433688 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 4-[(1-benzylpiperidin-4-yl)amino]-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-7-ol |
| SMILES | CN1CCCN(c2nc(NC3CCN(Cc4ccccc4)CC3)c3ccc(O)cc3n2)CC1 |
| InChI | InChI=1S/C26H34N6O/c1-30-12-5-13-32(17-16-30)26-28-24-18-22(33)8-9-23(24)25(29-26)27-21-10-14-31(15-11-21)19-20-6-3-2-4-7-20/h2-4,6-9,18,21,33H,5,10-17,19H2,1H3,(H,27,28,29) |
| InChIKey | SDISRTMZBGBDDZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |