C26H34N6 — CID 71570992
N-(1-benzylpiperidin-4-yl)-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-4-amine (PubChem CID 71570992) has the molecular formula C26H34N6 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-4-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 71570992 |
| Molecular Formula | C26H34N6 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-4-amine |
| SMILES | CN1CCCN(c2nc(NC3CCN(Cc4ccccc4)CC3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C26H34N6/c1-30-14-7-15-32(19-18-30)26-28-24-11-6-5-10-23(24)25(29-26)27-22-12-16-31(17-13-22)20-21-8-3-2-4-9-21/h2-6,8-11,22H,7,12-20H2,1H3,(H,27,28,29) |
| InChIKey | HSTHRYMYNLWUAD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |