C26H31ClN6O — CID 59682658
2-chloro-N-[2-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethyl]benzamide (PubChem CID 59682658) has the molecular formula C26H31ClN6O and a molecular weight of 479.03 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 59682658 |
| Molecular Formula | C26H31ClN6O |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2-chloro-N-[2-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CCN(c2nc(NC3CCCC3)c3ccccc3n2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C26H31ClN6O/c27-22-11-5-3-9-20(22)25(34)28-13-14-32-15-17-33(18-16-32)26-30-23-12-6-4-10-21(23)24(31-26)29-19-7-1-2-8-19/h3-6,9-12,19H,1-2,7-8,13-18H2,(H,28,34)(H,29,30,31) |
| InChIKey | PSTFGNNSNDKEMG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |