C27H29N5O2S — CID 4997573
N-cyclopentyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 4997573) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-cyclopentyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)quinazolin-4-amine.
| Compound Name | N-cyclopentyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 4997573 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-cyclopentyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCN(c2nc(NC3CCCC3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C27H29N5O2S/c33-35(34,23-14-13-20-7-1-2-8-21(20)19-23)32-17-15-31(16-18-32)27-29-25-12-6-5-11-24(25)26(30-27)28-22-9-3-4-10-22/h1-2,5-8,11-14,19,22H,3-4,9-10,15-18H2,(H,28,29,30) |
| InChIKey | HSOXXMCUDPOEPM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |